C19H18F3NO6 — CID 8013526
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3,4,5-trimethoxybenzoate (PubChem CID 8013526) has the molecular formula C19H18F3NO6 and a molecular weight of 413.35 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 8013526 |
| Molecular Formula | C19H18F3NO6 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2ccc(C(F)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18F3NO6/c1-26-14-8-11(9-15(27-2)17(14)28-3)18(25)29-10-16(24)23-13-6-4-12(5-7-13)19(20,21)22/h4-9H,10H2,1-3H3,(H,23,24) |
| InChIKey | FJHVVRWTSDGXQL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |