C20H17F6NO6 — CID 16525997
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 16525997) has the molecular formula C20H17F6NO6 and a molecular weight of 481.35 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 16525997 |
| Molecular Formula | C20H17F6NO6 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H17F6NO6/c1-30-14-7-13(8-15(31-2)17(14)32-3)27-16(28)9-33-18(29)10-4-11(19(21,22)23)6-12(5-10)20(24,25)26/h4-8H,9H2,1-3H3,(H,27,28) |
| InChIKey | YRJRSUWSUUYATR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |