C23H24N2O6 — CID 46694483
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-methyl-3-pyrrol-1-ylbenzoate (PubChem CID 46694483) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-methyl-3-pyrrol-1-ylbenzoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-methyl-3-pyrrol-1-ylbenzoate |
|---|---|
| PubChem CID | 46694483 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-methyl-3-pyrrol-1-ylbenzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2ccc(C)c(-n3cccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N2O6/c1-15-7-8-16(11-18(15)25-9-5-6-10-25)23(27)31-14-21(26)24-17-12-19(28-2)22(30-4)20(13-17)29-3/h5-13H,14H2,1-4H3,(H,24,26) |
| InChIKey | KEVXEWCCMCPVGY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |