C16H17NO7 — CID 46649127
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] furan-3-carboxylate (PubChem CID 46649127) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] furan-3-carboxylate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 46649127 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] furan-3-carboxylate |
| SMILES | COc1cc(NC(=O)COC(=O)c2ccoc2)cc(OC)c1OC |
| InChI | InChI=1S/C16H17NO7/c1-20-12-6-11(7-13(21-2)15(12)22-3)17-14(18)9-24-16(19)10-4-5-23-8-10/h4-8H,9H2,1-3H3,(H,17,18) |
| InChIKey | LRFROYWNUULCGE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |