C15H14N2O5 — CID 18102829
[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] furan-3-carboxylate (PubChem CID 18102829) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] furan-3-carboxylate.
| Compound Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 18102829 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] furan-3-carboxylate |
| SMILES | CNC(=O)c1cccc(NC(=O)COC(=O)c2ccoc2)c1 |
| InChI | InChI=1S/C15H14N2O5/c1-16-14(19)10-3-2-4-12(7-10)17-13(18)9-22-15(20)11-5-6-21-8-11/h2-8H,9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | KTFVDNVWPXIXRQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |