C16H16N4O4 — CID 9199802
[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate (PubChem CID 9199802) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 9199802 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [2-[3-(methylcarbamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
| SMILES | CNC(=O)c1cccc(NC(=O)COC(=O)c2cnc(C)cn2)c1 |
| InChI | InChI=1S/C16H16N4O4/c1-10-7-19-13(8-18-10)16(23)24-9-14(21)20-12-5-3-4-11(6-12)15(22)17-2/h3-8H,9H2,1-2H3,(H,17,22)(H,20,21) |
| InChIKey | COQCBVFLDWVQSN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |