C18H22N4O5S — CID 7950215
[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate (PubChem CID 7950215) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7950215 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2cnc(C)cn2)c1 |
| InChI | InChI=1S/C18H22N4O5S/c1-4-22(5-2)28(25,26)15-8-6-7-14(9-15)21-17(23)12-27-18(24)16-11-19-13(3)10-20-16/h6-11H,4-5,12H2,1-3H3,(H,21,23) |
| InChIKey | YXHAXIBRHPNERU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |