C16H24N2O5S — CID 7796929
[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] butanoate (PubChem CID 7796929) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] butanoate.
| Compound Name | [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] butanoate |
|---|---|
| PubChem CID | 7796929 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] butanoate |
| SMILES | CCCC(=O)OCC(=O)Nc1cccc(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C16H24N2O5S/c1-4-8-16(20)23-12-15(19)17-13-9-7-10-14(11-13)24(21,22)18(5-2)6-3/h7,9-11H,4-6,8,12H2,1-3H3,(H,17,19) |
| InChIKey | PSERYSBBIWUDKQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |