C23H27N3O6S — CID 42985627
[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 4-(cyclopropanecarbonylamino)benzoate (PubChem CID 42985627) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 4-(cyclopropanecarbonylamino)benzoate.
| Compound Name | [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 4-(cyclopropanecarbonylamino)benzoate |
|---|---|
| PubChem CID | 42985627 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | [2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl] 4-(cyclopropanecarbonylamino)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2ccc(NC(=O)C3CC3)cc2)c1 |
| InChI | InChI=1S/C23H27N3O6S/c1-3-26(4-2)33(30,31)20-7-5-6-19(14-20)24-21(27)15-32-23(29)17-10-12-18(13-11-17)25-22(28)16-8-9-16/h5-7,10-14,16H,3-4,8-9,15H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | ABCOFTHDOVIUKG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |