C19H29N3O5S — CID 42948173
ethyl 3-[[3-(diethylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 42948173) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is ethyl 3-[[3-(diethylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 3-[[3-(diethylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 42948173 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | ethyl 3-[[3-(diethylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(C(=O)Nc2cccc(S(=O)(=O)N(CC)CC)c2)C1 |
| InChI | InChI=1S/C19H29N3O5S/c1-4-22(5-2)28(25,26)17-11-7-10-16(13-17)20-18(23)15-9-8-12-21(14-15)19(24)27-6-3/h7,10-11,13,15H,4-6,8-9,12,14H2,1-3H3,(H,20,23) |
| InChIKey | USMDJVSZJBPTDA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |