C17H24N4O4S — CID 9073712
(3R)-3-N-(3-pyrrolidin-1-ylsulfonylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 9073712) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is (3R)-3-N-(3-pyrrolidin-1-ylsulfonylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-(3-pyrrolidin-1-ylsulfonylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 9073712 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (3R)-3-N-(3-pyrrolidin-1-ylsulfonylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCC[C@@H](C(=O)Nc2cccc(S(=O)(=O)N3CCCC3)c2)C1 |
| InChI | InChI=1S/C17H24N4O4S/c18-17(23)20-8-4-5-13(12-20)16(22)19-14-6-3-7-15(11-14)26(24,25)21-9-1-2-10-21/h3,6-7,11,13H,1-2,4-5,8-10,12H2,(H2,18,23)(H,19,22)/t13-/m1/s1 |
| InChIKey | DINWFIYPNJOSEC-CYBMUJFWSA-N |
| XLogP | 1.20 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |