C17H23ClN4O4S — CID 9086298
(3R)-3-[4-(3-chlorophenyl)sulfonylpiperazine-1-carbonyl]piperidine-1-carboxamide (PubChem CID 9086298) has the molecular formula C17H23ClN4O4S and a molecular weight of 414.92 g/mol. Its IUPAC name is (3R)-3-[4-(3-chlorophenyl)sulfonylpiperazine-1-carbonyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[4-(3-chlorophenyl)sulfonylpiperazine-1-carbonyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 9086298 |
| Molecular Formula | C17H23ClN4O4S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (3R)-3-[4-(3-chlorophenyl)sulfonylpiperazine-1-carbonyl]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC[C@@H](C(=O)N2CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C17H23ClN4O4S/c18-14-4-1-5-15(11-14)27(25,26)22-9-7-20(8-10-22)16(23)13-3-2-6-21(12-13)17(19)24/h1,4-5,11,13H,2-3,6-10,12H2,(H2,19,24)/t13-/m1/s1 |
| InChIKey | VLQAHSJIXMOXPZ-CYBMUJFWSA-N |
| XLogP | 0.96 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |