C18H26N4O4S — CID 9087013
(3R)-3-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]piperidine-1-carboxamide (PubChem CID 9087013) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is (3R)-3-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 9087013 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (3R)-3-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]piperidine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@@H]3CCCN(C(N)=O)C3)CC2)cc1 |
| InChI | InChI=1S/C18H26N4O4S/c1-14-4-6-16(7-5-14)27(25,26)22-11-9-20(10-12-22)17(23)15-3-2-8-21(13-15)18(19)24/h4-7,15H,2-3,8-13H2,1H3,(H2,19,24)/t15-/m1/s1 |
| InChIKey | MAVBAOYHIQIPJK-OAHLLOKOSA-N |
| XLogP | 0.62 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |