C19H27N3O5S — CID 9326800
1-[(3R)-3-[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 9326800) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-[(3R)-3-[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 9326800 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[(3R)-3-[4-(4-methoxyphenyl)sulfonylpiperazine-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)[C@@H]3CCCN(C(C)=O)C3)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O5S/c1-15(23)21-9-3-4-16(14-21)19(24)20-10-12-22(13-11-20)28(25,26)18-7-5-17(27-2)6-8-18/h5-8,16H,3-4,9-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | UAISGJKUVBOWTM-MRXNPFEDSA-N |
| XLogP | 0.79 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |