C25H37N3O5S — CID 45354498
azepan-1-yl-[1-[1-(4-methoxyphenyl)sulfonylpiperidine-3-carbonyl]piperidin-4-yl]methanone (PubChem CID 45354498) has the molecular formula C25H37N3O5S and a molecular weight of 491.65 g/mol. Its IUPAC name is azepan-1-yl-[1-[1-(4-methoxyphenyl)sulfonylpiperidine-3-carbonyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[1-(4-methoxyphenyl)sulfonylpiperidine-3-carbonyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 45354498 |
| Molecular Formula | C25H37N3O5S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | azepan-1-yl-[1-[1-(4-methoxyphenyl)sulfonylpiperidine-3-carbonyl]piperidin-4-yl]methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)N3CCC(C(=O)N4CCCCCC4)CC3)C2)cc1 |
| InChI | InChI=1S/C25H37N3O5S/c1-33-22-8-10-23(11-9-22)34(31,32)28-16-6-7-21(19-28)25(30)27-17-12-20(13-18-27)24(29)26-14-4-2-3-5-15-26/h8-11,20-21H,2-7,12-19H2,1H3 |
| InChIKey | BLUBNQIDZYHALD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |