C19H25FN2O5S — CID 40947352
methyl 1-[(3S)-1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]piperidine-4-carboxylate (PubChem CID 40947352) has the molecular formula C19H25FN2O5S and a molecular weight of 412.48 g/mol. Its IUPAC name is methyl 1-[(3S)-1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(3S)-1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 40947352 |
| Molecular Formula | C19H25FN2O5S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | methyl 1-[(3S)-1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)[C@H]2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C19H25FN2O5S/c1-27-19(24)14-8-11-21(12-9-14)18(23)15-3-2-10-22(13-15)28(25,26)17-6-4-16(20)5-7-17/h4-7,14-15H,2-3,8-13H2,1H3/t15-/m0/s1 |
| InChIKey | LFQAKONLBDBUCW-HNNXBMFYSA-N |
| XLogP | 1.64 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |