C16H23ClFN3O3S — CID 119400137
[1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119400137) has the molecular formula C16H23ClFN3O3S and a molecular weight of 391.90 g/mol. Its IUPAC name is [1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | [1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119400137 |
| Molecular Formula | C16H23ClFN3O3S |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1)N1CCNCC1 |
| InChI | InChI=1S/C16H22FN3O3S.ClH/c17-14-3-5-15(6-4-14)24(22,23)20-9-1-2-13(12-20)16(21)19-10-7-18-8-11-19;/h3-6,13,18H,1-2,7-12H2;1H |
| InChIKey | GPEOEGRWMSWJRN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |