C18H26FN3O3S — CID 119441227
1-(4-fluorophenyl)sulfonyl-N-methyl-N-piperidin-4-ylpiperidine-3-carboxamide (PubChem CID 119441227) has the molecular formula C18H26FN3O3S and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-methyl-N-piperidin-4-ylpiperidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-methyl-N-piperidin-4-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 119441227 |
| Molecular Formula | C18H26FN3O3S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-methyl-N-piperidin-4-ylpiperidine-3-carboxamide |
| SMILES | CN(C(=O)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1)C1CCNCC1 |
| InChI | InChI=1S/C18H26FN3O3S/c1-21(16-8-10-20-11-9-16)18(23)14-3-2-12-22(13-14)26(24,25)17-6-4-15(19)5-7-17/h4-7,14,16,20H,2-3,8-13H2,1H3 |
| InChIKey | VOTPOPFVFXUKOI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |