C15H22N2O3S — CID 30156240
(3S)-N,N-dimethyl-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 30156240) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is (3S)-N,N-dimethyl-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N,N-dimethyl-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 30156240 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (3S)-N,N-dimethyl-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)N(C)C)C2)cc1 |
| InChI | InChI=1S/C15H22N2O3S/c1-12-6-8-14(9-7-12)21(19,20)17-10-4-5-13(11-17)15(18)16(2)3/h6-9,13H,4-5,10-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | UPDWTZSPAJUOQD-ZDUSSCGKSA-N |
| XLogP | 1.48 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |