C19H27N3O4S — CID 9473935
(3R)-N'-(cyclopentanecarbonyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide (PubChem CID 9473935) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is (3R)-N'-(cyclopentanecarbonyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide.
| Compound Name | (3R)-N'-(cyclopentanecarbonyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 9473935 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3R)-N'-(cyclopentanecarbonyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@@H](C(=O)NNC(=O)C3CCCC3)C2)cc1 |
| InChI | InChI=1S/C19H27N3O4S/c1-14-8-10-17(11-9-14)27(25,26)22-12-4-7-16(13-22)19(24)21-20-18(23)15-5-2-3-6-15/h8-11,15-16H,2-7,12-13H2,1H3,(H,20,23)(H,21,24)/t16-/m1/s1 |
| InChIKey | CZILMTJIHFZNFQ-MRXNPFEDSA-N |
| XLogP | 1.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|