C19H27N3O6S — CID 9087133
ethyl 4-[2-[(3R)-1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]hydrazinyl]-4-oxobutanoate (PubChem CID 9087133) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is ethyl 4-[2-[(3R)-1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]hydrazinyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-[(3R)-1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 9087133 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl 4-[2-[(3R)-1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]hydrazinyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NNC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C19H27N3O6S/c1-3-28-18(24)11-10-17(23)20-21-19(25)15-5-4-12-22(13-15)29(26,27)16-8-6-14(2)7-9-16/h6-9,15H,3-5,10-13H2,1-2H3,(H,20,23)(H,21,25)/t15-/m1/s1 |
| InChIKey | HDWGJSIIXHHIKL-OAHLLOKOSA-N |
| XLogP | 0.89 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|