C21H25NO6S2 — CID 170561359
ethyl (3R)-1-[4-(4-methylsulfonylphenyl)phenyl]sulfonylpiperidine-3-carboxylate (PubChem CID 170561359) has the molecular formula C21H25NO6S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is ethyl (3R)-1-[4-(4-methylsulfonylphenyl)phenyl]sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[4-(4-methylsulfonylphenyl)phenyl]sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 170561359 |
| Molecular Formula | C21H25NO6S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | ethyl (3R)-1-[4-(4-methylsulfonylphenyl)phenyl]sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(-c3ccc(S(C)(=O)=O)cc3)cc2)C1 |
| InChI | InChI=1S/C21H25NO6S2/c1-3-28-21(23)18-5-4-14-22(15-18)30(26,27)20-12-8-17(9-13-20)16-6-10-19(11-7-16)29(2,24)25/h6-13,18H,3-5,14-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | PUIONAOSBCBOCO-GOSISDBHSA-N |
| XLogP | 2.72 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |