C14H20N2O6S2 — CID 2198274
ethyl (3R)-1-(4-sulfamoylphenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 2198274) has the molecular formula C14H20N2O6S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl (3R)-1-(4-sulfamoylphenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(4-sulfamoylphenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 2198274 |
| Molecular Formula | C14H20N2O6S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | ethyl (3R)-1-(4-sulfamoylphenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C14H20N2O6S2/c1-2-22-14(17)11-4-3-9-16(10-11)24(20,21)13-7-5-12(6-8-13)23(15,18)19/h5-8,11H,2-4,9-10H2,1H3,(H2,15,18,19)/t11-/m1/s1 |
| InChIKey | MBQROBXCMJUKDM-LLVKDONJSA-N |
| XLogP | 0.30 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |