C12H16N2O6S2 — CID 23607546
1-(4-sulfamoylphenyl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 23607546) has the molecular formula C12H16N2O6S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 1-(4-sulfamoylphenyl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 23607546 |
| Molecular Formula | C12H16N2O6S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-(4-sulfamoylphenyl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C12H16N2O6S2/c13-21(17,18)10-3-5-11(6-4-10)22(19,20)14-7-1-2-9(8-14)12(15)16/h3-6,9H,1-2,7-8H2,(H,15,16)(H2,13,17,18) |
| InChIKey | OKLXDZNYABUGCY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |