C17H22N2O5S — CID 162659300
(3R)-1-[4-(1-methyl-5-oxopyrrolidin-3-yl)phenyl]sulfonylpiperidine-3-carboxylic acid (PubChem CID 162659300) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is (3R)-1-[4-(1-methyl-5-oxopyrrolidin-3-yl)phenyl]sulfonylpiperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[4-(1-methyl-5-oxopyrrolidin-3-yl)phenyl]sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 162659300 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3R)-1-[4-(1-methyl-5-oxopyrrolidin-3-yl)phenyl]sulfonylpiperidine-3-carboxylic acid |
| SMILES | CN1CC(c2ccc(S(=O)(=O)N3CCC[C@@H](C(=O)O)C3)cc2)CC1=O |
| InChI | InChI=1S/C17H22N2O5S/c1-18-10-14(9-16(18)20)12-4-6-15(7-5-12)25(23,24)19-8-2-3-13(11-19)17(21)22/h4-7,13-14H,2-3,8-11H2,1H3,(H,21,22)/t13-,14?/m1/s1 |
| InChIKey | BKNBMCIUDQMLKW-KWCCSABGSA-N |
| XLogP | 1.12 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |