C14H20N2O6S2 — CID 120660318
1-[3-methyl-4-(methylsulfamoyl)phenyl]sulfonylpiperidine-3-carboxylic acid (PubChem CID 120660318) has the molecular formula C14H20N2O6S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[3-methyl-4-(methylsulfamoyl)phenyl]sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 1-[3-methyl-4-(methylsulfamoyl)phenyl]sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120660318 |
| Molecular Formula | C14H20N2O6S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-[3-methyl-4-(methylsulfamoyl)phenyl]sulfonylpiperidine-3-carboxylic acid |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)N2CCCC(C(=O)O)C2)cc1C |
| InChI | InChI=1S/C14H20N2O6S2/c1-10-8-12(5-6-13(10)23(19,20)15-2)24(21,22)16-7-3-4-11(9-16)14(17)18/h5-6,8,11,15H,3-4,7,9H2,1-2H3,(H,17,18) |
| InChIKey | OFRHRVAZDLIMJQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |