C19H23N3O5S2 — CID 16863432
1-(4-methylphenyl)sulfonyl-N-(4-sulfamoylphenyl)piperidine-3-carboxamide (PubChem CID 16863432) has the molecular formula C19H23N3O5S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-(4-sulfamoylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-(4-sulfamoylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 16863432 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-(4-sulfamoylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)Nc3ccc(S(N)(=O)=O)cc3)C2)cc1 |
| InChI | InChI=1S/C19H23N3O5S2/c1-14-4-8-18(9-5-14)29(26,27)22-12-2-3-15(13-22)19(23)21-16-6-10-17(11-7-16)28(20,24)25/h4-11,15H,2-3,12-13H2,1H3,(H,21,23)(H2,20,24,25) |
| InChIKey | FIRVBTASNOSCFB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |