C25H32N2O3S — CID 1455619
(3S)-N-(4-cyclohexylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 1455619) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is (3S)-N-(4-cyclohexylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(4-cyclohexylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 1455619 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (3S)-N-(4-cyclohexylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)Nc3ccc(C4CCCCC4)cc3)C2)cc1 |
| InChI | InChI=1S/C25H32N2O3S/c1-19-9-15-24(16-10-19)31(29,30)27-17-5-8-22(18-27)25(28)26-23-13-11-21(12-14-23)20-6-3-2-4-7-20/h9-16,20,22H,2-8,17-18H2,1H3,(H,26,28)/t22-/m0/s1 |
| InChIKey | IKAQHNHXTMJDPK-QFIPXVFZSA-N |
| XLogP | 5.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |