C20H25N3O6S2 — CID 3899735
1-(2-methoxy-5-methylphenyl)sulfonyl-N-(4-sulfamoylphenyl)piperidine-3-carboxamide (PubChem CID 3899735) has the molecular formula C20H25N3O6S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)sulfonyl-N-(4-sulfamoylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-(2-methoxy-5-methylphenyl)sulfonyl-N-(4-sulfamoylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 3899735 |
| Molecular Formula | C20H25N3O6S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)sulfonyl-N-(4-sulfamoylphenyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CCCC(C(=O)Nc2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C20H25N3O6S2/c1-14-5-10-18(29-2)19(12-14)31(27,28)23-11-3-4-15(13-23)20(24)22-16-6-8-17(9-7-16)30(21,25)26/h5-10,12,15H,3-4,11,13H2,1-2H3,(H,22,24)(H2,21,25,26) |
| InChIKey | IMOLFKULBDVSEV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |