C19H22BrN3O5S2 — CID 43874859
1-(4-bromophenyl)sulfonyl-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 43874859) has the molecular formula C19H22BrN3O5S2 and a molecular weight of 516.44 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43874859 |
| Molecular Formula | C19H22BrN3O5S2 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C2CCCN(S(=O)(=O)c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C19H22BrN3O5S2/c20-16-5-9-18(10-6-16)30(27,28)23-11-1-2-15(13-23)19(24)22-12-14-3-7-17(8-4-14)29(21,25)26/h3-10,15H,1-2,11-13H2,(H,22,24)(H2,21,25,26) |
| InChIKey | VTAAUICCWTXJLH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |