C19H29N3O5S2 — CID 28562313
(3S)-1-ethylsulfonyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 28562313) has the molecular formula C19H29N3O5S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is (3S)-1-ethylsulfonyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-ethylsulfonyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28562313 |
| Molecular Formula | C19H29N3O5S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (3S)-1-ethylsulfonyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@H](C(=O)NCc2ccc(S(=O)(=O)N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C19H29N3O5S2/c1-2-28(24,25)22-13-5-6-17(15-22)19(23)20-14-16-7-9-18(10-8-16)29(26,27)21-11-3-4-12-21/h7-10,17H,2-6,11-15H2,1H3,(H,20,23)/t17-/m0/s1 |
| InChIKey | SCTFWYMBUPMZHD-KRWDZBQOSA-N |
| XLogP | 1.15 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |