C17H27N3O5S2 — CID 28562303
(3R)-N-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethylsulfonylpiperidine-3-carboxamide (PubChem CID 28562303) has the molecular formula C17H27N3O5S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (3R)-N-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 28562303 |
| Molecular Formula | C17H27N3O5S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (3R)-N-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethylsulfonylpiperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@@H](C(=O)NCc2ccc(S(=O)(=O)N(C)C)cc2)C1 |
| InChI | InChI=1S/C17H27N3O5S2/c1-4-26(22,23)20-11-5-6-15(13-20)17(21)18-12-14-7-9-16(10-8-14)27(24,25)19(2)3/h7-10,15H,4-6,11-13H2,1-3H3,(H,18,21)/t15-/m1/s1 |
| InChIKey | RNTIEUNYLNTDNQ-OAHLLOKOSA-N |
| XLogP | 0.61 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |