C20H23BrN2O3S — CID 2978458
1-(4-bromophenyl)sulfonyl-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 2978458) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 2978458 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCCN(S(=O)(=O)c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C20H23BrN2O3S/c1-15-4-6-16(7-5-15)13-22-20(24)17-3-2-12-23(14-17)27(25,26)19-10-8-18(21)9-11-19/h4-11,17H,2-3,12-14H2,1H3,(H,22,24) |
| InChIKey | GVYNVPRDBRWAMO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |