C23H25N3O5S2 — CID 28562145
(3R)-1-naphthalen-2-ylsulfonyl-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 28562145) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is (3R)-1-naphthalen-2-ylsulfonyl-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-naphthalen-2-ylsulfonyl-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28562145 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | (3R)-1-naphthalen-2-ylsulfonyl-N-[(4-sulfamoylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)[C@@H]2CCCN(S(=O)(=O)c3ccc4ccccc4c3)C2)cc1 |
| InChI | InChI=1S/C23H25N3O5S2/c24-32(28,29)21-10-7-17(8-11-21)15-25-23(27)20-6-3-13-26(16-20)33(30,31)22-12-9-18-4-1-2-5-19(18)14-22/h1-2,4-5,7-12,14,20H,3,6,13,15-16H2,(H,25,27)(H2,24,28,29)/t20-/m1/s1 |
| InChIKey | ORTKRGKUGGQJKJ-HXUWFJFHSA-N |
| XLogP | 2.20 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |