C25H28N2O5S — CID 133159777
N-[(2,6-dimethoxyphenyl)methyl]-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 133159777) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-[(2,6-dimethoxyphenyl)methyl]-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[(2,6-dimethoxyphenyl)methyl]-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 133159777 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-[(2,6-dimethoxyphenyl)methyl]-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | COc1cccc(OC)c1CNC(=O)C1CCCN(S(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C25H28N2O5S/c1-31-23-10-5-11-24(32-2)22(23)16-26-25(28)20-9-6-14-27(17-20)33(29,30)21-13-12-18-7-3-4-8-19(18)15-21/h3-5,7-8,10-13,15,20H,6,9,14,16-17H2,1-2H3,(H,26,28) |
| InChIKey | GUHWJWZTPLDGIC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |