C24H26N2O3S — CID 40976117
(3S)-N-(2,6-dimethylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 40976117) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is (3S)-N-(2,6-dimethylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(2,6-dimethylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 40976117 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (3S)-N-(2,6-dimethylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)[C@H]1CCCN(S(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C24H26N2O3S/c1-17-7-5-8-18(2)23(17)25-24(27)21-11-6-14-26(16-21)30(28,29)22-13-12-19-9-3-4-10-20(19)15-22/h3-5,7-10,12-13,15,21H,6,11,14,16H2,1-2H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | BNNCHFAVUFBTDS-NRFANRHFSA-N |
| XLogP | 4.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |