C24H26N2O3S — CID 4530655
N-(2,5-dimethylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 4530655) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 4530655 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2CCCN(S(=O)(=O)c3ccc4ccccc4c3)C2)c1 |
| InChI | InChI=1S/C24H26N2O3S/c1-17-9-10-18(2)23(14-17)25-24(27)21-8-5-13-26(16-21)30(28,29)22-12-11-19-6-3-4-7-20(19)15-22/h3-4,6-7,9-12,14-15,21H,5,8,13,16H2,1-2H3,(H,25,27) |
| InChIKey | QSBMQKQZISXKCD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |