C12H15N2O4S- — CID 6951914
(3S)-1-(4-aminophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 6951914) has the molecular formula C12H15N2O4S- and a molecular weight of 283.33 g/mol. Its IUPAC name is (3S)-1-(4-aminophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (3S)-1-(4-aminophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 6951914 |
| Molecular Formula | C12H15N2O4S- |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (3S)-1-(4-aminophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | Nc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)[O-])C2)cc1 |
| InChI | InChI=1S/C12H16N2O4S/c13-10-3-5-11(6-4-10)19(17,18)14-7-1-2-9(8-14)12(15)16/h3-6,9H,1-2,7-8,13H2,(H,15,16)/p-1/t9-/m0/s1 |
| InChIKey | GAGYZNBUGHVVSV-VIFPVBQESA-M |
| XLogP | -0.58 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|