C12H13N2O6S- — CID 7058472
(3S)-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 7058472) has the molecular formula C12H13N2O6S- and a molecular weight of 313.31 g/mol. Its IUPAC name is (3S)-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (3S)-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 7058472 |
| Molecular Formula | C12H13N2O6S- |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (3S)-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C12H14N2O6S/c15-12(16)9-3-2-6-13(8-9)21(19,20)11-5-1-4-10(7-11)14(17)18/h1,4-5,7,9H,2-3,6,8H2,(H,15,16)/p-1/t9-/m0/s1 |
| InChIKey | AVATZSJXFSPYLU-VIFPVBQESA-M |
| XLogP | -0.25 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|