C17H23N3O7S2 — CID 41144914
(3R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 41144914) has the molecular formula C17H23N3O7S2 and a molecular weight of 445.52 g/mol. Its IUPAC name is (3R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 41144914 |
| Molecular Formula | C17H23N3O7S2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (3R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CN(C(=O)[C@@H]1CCCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)C1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23N3O7S2/c1-18(15-7-9-28(24,25)12-15)17(21)13-4-3-8-19(11-13)29(26,27)16-6-2-5-14(10-16)20(22)23/h2,5-6,10,13,15H,3-4,7-9,11-12H2,1H3/t13-,15+/m1/s1 |
| InChIKey | SVJUVQHYIREBRU-HIFRSBDPSA-N |
| XLogP | 0.64 |
| TPSA | 134.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|