C33H37N5O7S — CID 44825740
N-[4-[2-[3-[cyclopentyl(methyl)carbamoyl]anilino]-2-oxoethyl]phenyl]-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 44825740) has the molecular formula C33H37N5O7S and a molecular weight of 647.75 g/mol. Its IUPAC name is N-[4-[2-[3-[cyclopentyl(methyl)carbamoyl]anilino]-2-oxoethyl]phenyl]-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[4-[2-[3-[cyclopentyl(methyl)carbamoyl]anilino]-2-oxoethyl]phenyl]-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 44825740 |
| Molecular Formula | C33H37N5O7S |
| Molecular Weight | 647.75 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | N-[4-[2-[3-[cyclopentyl(methyl)carbamoyl]anilino]-2-oxoethyl]phenyl]-1-(3-nitrophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CN(C(=O)c1cccc(NC(=O)Cc2ccc(NC(=O)C3CCCN(S(=O)(=O)c4cccc([N+](=O)[O-])c4)C3)cc2)c1)C1CCCC1 |
| InChI | InChI=1S/C33H37N5O7S/c1-36(28-10-2-3-11-28)33(41)24-7-4-9-27(20-24)34-31(39)19-23-14-16-26(17-15-23)35-32(40)25-8-6-18-37(22-25)46(44,45)30-13-5-12-29(21-30)38(42)43/h4-5,7,9,12-17,20-21,25,28H,2-3,6,8,10-11,18-19,22H2,1H3,(H,34,39)(H,35,40) |
| InChIKey | ZCVUURRUXOCYHN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.75 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|