C16H23N3O4S — CID 55556995
N-[3-(dimethylcarbamoyl)phenyl]-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 55556995) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[3-(dimethylcarbamoyl)phenyl]-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(dimethylcarbamoyl)phenyl]-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55556995 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[3-(dimethylcarbamoyl)phenyl]-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)C2CCCN(S(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C16H23N3O4S/c1-18(2)16(21)12-6-4-8-14(10-12)17-15(20)13-7-5-9-19(11-13)24(3,22)23/h4,6,8,10,13H,5,7,9,11H2,1-3H3,(H,17,20) |
| InChIKey | XWTCPPAKSHIGPY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |