C19H23N5O2 — CID 46597194
N-[3-(dimethylcarbamoyl)phenyl]-1-pyrazin-2-ylpiperidine-3-carboxamide (PubChem CID 46597194) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-[3-(dimethylcarbamoyl)phenyl]-1-pyrazin-2-ylpiperidine-3-carboxamide.
| Compound Name | N-[3-(dimethylcarbamoyl)phenyl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46597194 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[3-(dimethylcarbamoyl)phenyl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)C2CCCN(c3cnccn3)C2)c1 |
| InChI | InChI=1S/C19H23N5O2/c1-23(2)19(26)14-5-3-7-16(11-14)22-18(25)15-6-4-10-24(13-15)17-12-20-8-9-21-17/h3,5,7-9,11-12,15H,4,6,10,13H2,1-2H3,(H,22,25) |
| InChIKey | QYGCGWRXGIJJSZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |