C14H20N2O3S2 — CID 7258371
(3S)-N-(3-methylsulfanylphenyl)-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 7258371) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (3S)-N-(3-methylsulfanylphenyl)-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-methylsulfanylphenyl)-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 7258371 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (3S)-N-(3-methylsulfanylphenyl)-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | CSc1cccc(NC(=O)[C@H]2CCCN(S(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-20-13-7-3-6-12(9-13)15-14(17)11-5-4-8-16(10-11)21(2,18)19/h3,6-7,9,11H,4-5,8,10H2,1-2H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | XINBUYVUMOWZFS-NSHDSACASA-N |
| XLogP | 2.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |