C13H16BrClN2O3S — CID 146337072
(3S)-N-(3-bromo-4-chlorophenyl)-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 146337072) has the molecular formula C13H16BrClN2O3S and a molecular weight of 395.71 g/mol. Its IUPAC name is (3S)-N-(3-bromo-4-chlorophenyl)-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-bromo-4-chlorophenyl)-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 146337072 |
| Molecular Formula | C13H16BrClN2O3S |
| Molecular Weight | 395.71 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | (3S)-N-(3-bromo-4-chlorophenyl)-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCC[C@H](C(=O)Nc2ccc(Cl)c(Br)c2)C1 |
| InChI | InChI=1S/C13H16BrClN2O3S/c1-21(19,20)17-6-2-3-9(8-17)13(18)16-10-4-5-12(15)11(14)7-10/h4-5,7,9H,2-3,6,8H2,1H3,(H,16,18)/t9-/m0/s1 |
| InChIKey | PIOKRVSIAHKXMQ-VIFPVBQESA-N |
| XLogP | 2.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.71 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |