C14H18ClFN2O3S — CID 41447116
(3S)-N-(3-chloro-4-fluorophenyl)-1-ethylsulfonylpiperidine-3-carboxamide (PubChem CID 41447116) has the molecular formula C14H18ClFN2O3S and a molecular weight of 348.83 g/mol. Its IUPAC name is (3S)-N-(3-chloro-4-fluorophenyl)-1-ethylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-chloro-4-fluorophenyl)-1-ethylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 41447116 |
| Molecular Formula | C14H18ClFN2O3S |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (3S)-N-(3-chloro-4-fluorophenyl)-1-ethylsulfonylpiperidine-3-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@H](C(=O)Nc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H18ClFN2O3S/c1-2-22(20,21)18-7-3-4-10(9-18)14(19)17-11-5-6-13(16)12(15)8-11/h5-6,8,10H,2-4,7,9H2,1H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | ARYGBDBJMXHSMJ-JTQLQIEISA-N |
| XLogP | 2.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |