C19H19Cl2FN2O — CID 43923085
N-(3-chloro-4-fluorophenyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43923085) has the molecular formula C19H19Cl2FN2O and a molecular weight of 381.28 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43923085 |
| Molecular Formula | C19H19Cl2FN2O |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)C1CCCN(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H19Cl2FN2O/c20-15-5-3-13(4-6-15)11-24-9-1-2-14(12-24)19(25)23-16-7-8-18(22)17(21)10-16/h3-8,10,14H,1-2,9,11-12H2,(H,23,25) |
| InChIKey | GMWYQGHWTGLLMH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |