C22H24ClFN2O3 — CID 94025825
ethyl 2-chloro-4-[[(3R)-1-[(4-fluorophenyl)methyl]piperidine-3-carbonyl]amino]benzoate (PubChem CID 94025825) has the molecular formula C22H24ClFN2O3 and a molecular weight of 418.90 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[(3R)-1-[(4-fluorophenyl)methyl]piperidine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[(3R)-1-[(4-fluorophenyl)methyl]piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 94025825 |
| Molecular Formula | C22H24ClFN2O3 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | ethyl 2-chloro-4-[[(3R)-1-[(4-fluorophenyl)methyl]piperidine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H]2CCCN(Cc3ccc(F)cc3)C2)cc1Cl |
| InChI | InChI=1S/C22H24ClFN2O3/c1-2-29-22(28)19-10-9-18(12-20(19)23)25-21(27)16-4-3-11-26(14-16)13-15-5-7-17(24)8-6-15/h5-10,12,16H,2-4,11,13-14H2,1H3,(H,25,27)/t16-/m1/s1 |
| InChIKey | KFEOYCLDGTWTLK-MRXNPFEDSA-N |
| XLogP | 4.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |