C16H26N4O5S2 — CID 43916583
1-(dimethylsulfamoyl)-N-[3-[methyl(methylsulfonyl)amino]phenyl]piperidine-3-carboxamide (PubChem CID 43916583) has the molecular formula C16H26N4O5S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-(dimethylsulfamoyl)-N-[3-[methyl(methylsulfonyl)amino]phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(dimethylsulfamoyl)-N-[3-[methyl(methylsulfonyl)amino]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43916583 |
| Molecular Formula | C16H26N4O5S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 1-(dimethylsulfamoyl)-N-[3-[methyl(methylsulfonyl)amino]phenyl]piperidine-3-carboxamide |
| SMILES | CN(c1cccc(NC(=O)C2CCCN(S(=O)(=O)N(C)C)C2)c1)S(C)(=O)=O |
| InChI | InChI=1S/C16H26N4O5S2/c1-18(2)27(24,25)20-10-6-7-13(12-20)16(21)17-14-8-5-9-15(11-14)19(3)26(4,22)23/h5,8-9,11,13H,6-7,10,12H2,1-4H3,(H,17,21) |
| InChIKey | DOEITJPZNHPLGZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |