C18H23N3O3S — CID 30397988
(3S)-1-(dimethylsulfamoyl)-N-naphthalen-2-ylpiperidine-3-carboxamide (PubChem CID 30397988) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is (3S)-1-(dimethylsulfamoyl)-N-naphthalen-2-ylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(dimethylsulfamoyl)-N-naphthalen-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 30397988 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (3S)-1-(dimethylsulfamoyl)-N-naphthalen-2-ylpiperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@H](C(=O)Nc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C18H23N3O3S/c1-20(2)25(23,24)21-11-5-8-16(13-21)18(22)19-17-10-9-14-6-3-4-7-15(14)12-17/h3-4,6-7,9-10,12,16H,5,8,11,13H2,1-2H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | MSIRXKOAEJZLBN-INIZCTEOSA-N |
| XLogP | 2.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |